C21H22ClN5O — CID 24955585
4-(4-chlorophenyl)-N-methyl-5-phenyl-N-piperidin-1-yltriazole-2-carboxamide (PubChem CID 24955585) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-methyl-5-phenyl-N-piperidin-1-yltriazole-2-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-methyl-5-phenyl-N-piperidin-1-yltriazole-2-carboxamide |
|---|---|
| PubChem CID | 24955585 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-(4-chlorophenyl)-N-methyl-5-phenyl-N-piperidin-1-yltriazole-2-carboxamide |
| SMILES | CN(C(=O)n1nc(-c2ccccc2)c(-c2ccc(Cl)cc2)n1)N1CCCCC1 |
| InChI | InChI=1S/C21H22ClN5O/c1-25(26-14-6-3-7-15-26)21(28)27-23-19(16-8-4-2-5-9-16)20(24-27)17-10-12-18(22)13-11-17/h2,4-5,8-13H,3,6-7,14-15H2,1H3 |
| InChIKey | UKZCAWKKSKWGNV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |