C15H19N3O3S — CID 24956127
2-(4-ethoxyphenyl)imino-3-(2-hydroxyethyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 24956127) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)imino-3-(2-hydroxyethyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)imino-3-(2-hydroxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24956127 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(4-ethoxyphenyl)imino-3-(2-hydroxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCOc1ccc(/N=c2/sc(C(N)=O)c(C)n2CCO)cc1 |
| InChI | InChI=1S/C15H19N3O3S/c1-3-21-12-6-4-11(5-7-12)17-15-18(8-9-19)10(2)13(22-15)14(16)20/h4-7,19H,3,8-9H2,1-2H3,(H2,16,20)/b17-15+ |
| InChIKey | VZVQJLPZSUYKKU-BMRADRMJSA-N |
| XLogP | 1.58 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|