C17H15N3O2 — CID 24956253
N,N-dimethyl-2-oxo-3-phenylquinoxaline-1-carboxamide (PubChem CID 24956253) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is N,N-dimethyl-2-oxo-3-phenylquinoxaline-1-carboxamide.
| Compound Name | N,N-dimethyl-2-oxo-3-phenylquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 24956253 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N,N-dimethyl-2-oxo-3-phenylquinoxaline-1-carboxamide |
| SMILES | CN(C)C(=O)n1c(=O)c(-c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C17H15N3O2/c1-19(2)17(22)20-14-11-7-6-10-13(14)18-15(16(20)21)12-8-4-3-5-9-12/h3-11H,1-2H3 |
| InChIKey | NZVQJSMPDUHYIA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |