C29H31N3O2 — CID 53383103
2-(2-oxo-3-phenylquinoxalin-1-yl)-N-pentyl-4-phenylbutanamide (PubChem CID 53383103) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-(2-oxo-3-phenylquinoxalin-1-yl)-N-pentyl-4-phenylbutanamide.
| Compound Name | 2-(2-oxo-3-phenylquinoxalin-1-yl)-N-pentyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 53383103 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-(2-oxo-3-phenylquinoxalin-1-yl)-N-pentyl-4-phenylbutanamide |
| SMILES | CCCCCNC(=O)C(CCc1ccccc1)n1c(=O)c(-c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C29H31N3O2/c1-2-3-12-21-30-28(33)26(20-19-22-13-6-4-7-14-22)32-25-18-11-10-17-24(25)31-27(29(32)34)23-15-8-5-9-16-23/h4-11,13-18,26H,2-3,12,19-21H2,1H3,(H,30,33) |
| InChIKey | QNXWUGREBLPOBJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|