C33H28N4O2 — CID 53383368
N-benzyl-2-[3-(1H-indol-2-yl)-2-oxoquinoxalin-1-yl]-4-phenylbutanamide (PubChem CID 53383368) has the molecular formula C33H28N4O2 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-benzyl-2-[3-(1H-indol-2-yl)-2-oxoquinoxalin-1-yl]-4-phenylbutanamide.
| Compound Name | N-benzyl-2-[3-(1H-indol-2-yl)-2-oxoquinoxalin-1-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 53383368 |
| Molecular Formula | C33H28N4O2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | N-benzyl-2-[3-(1H-indol-2-yl)-2-oxoquinoxalin-1-yl]-4-phenylbutanamide |
| SMILES | O=C(NCc1ccccc1)C(CCc1ccccc1)n1c(=O)c(-c2cc3ccccc3[nH]2)nc2ccccc21 |
| InChI | InChI=1S/C33H28N4O2/c38-32(34-22-24-13-5-2-6-14-24)30(20-19-23-11-3-1-4-12-23)37-29-18-10-9-17-27(29)36-31(33(37)39)28-21-25-15-7-8-16-26(25)35-28/h1-18,21,30,35H,19-20,22H2,(H,34,38) |
| InChIKey | COUMLOANJNYXCF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |