C28H20F3N3O3 — CID 53383163
N-benzyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 53383163) has the molecular formula C28H20F3N3O3 and a molecular weight of 503.48 g/mol. Its IUPAC name is N-benzyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-benzyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 53383163 |
| Molecular Formula | C28H20F3N3O3 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-benzyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(NCc1ccccc1)C(c1ccc(C(F)(F)F)cc1)n1c(=O)c(-c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C28H20F3N3O3/c29-28(30,31)20-14-12-19(13-15-20)25(26(35)32-17-18-7-2-1-3-8-18)34-22-10-5-4-9-21(22)33-24(27(34)36)23-11-6-16-37-23/h1-16,25H,17H2,(H,32,35) |
| InChIKey | ORXWMFFTUQCKTP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |