C30H22N4O4 — CID 53383349
2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-N-(4-methoxyphenyl)-2-quinolin-4-ylacetamide (PubChem CID 53383349) has the molecular formula C30H22N4O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-N-(4-methoxyphenyl)-2-quinolin-4-ylacetamide.
| Compound Name | 2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-N-(4-methoxyphenyl)-2-quinolin-4-ylacetamide |
|---|---|
| PubChem CID | 53383349 |
| Molecular Formula | C30H22N4O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-N-(4-methoxyphenyl)-2-quinolin-4-ylacetamide |
| SMILES | COc1ccc(NC(=O)C(c2ccnc3ccccc23)n2c(=O)c(-c3ccco3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H22N4O4/c1-37-20-14-12-19(13-15-20)32-29(35)28(22-16-17-31-23-8-3-2-7-21(22)23)34-25-10-5-4-9-24(25)33-27(30(34)36)26-11-6-18-38-26/h2-18,28H,1H3,(H,32,35) |
| InChIKey | WAGLVRMLVMEZQG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |