C29H26N4O3 — CID 53383330
N-cyclohexyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-quinolin-4-ylacetamide (PubChem CID 53383330) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-quinolin-4-ylacetamide.
| Compound Name | N-cyclohexyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-quinolin-4-ylacetamide |
|---|---|
| PubChem CID | 53383330 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-cyclohexyl-2-[3-(furan-2-yl)-2-oxoquinoxalin-1-yl]-2-quinolin-4-ylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccnc2ccccc12)n1c(=O)c(-c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C29H26N4O3/c34-28(31-19-9-2-1-3-10-19)27(21-16-17-30-22-12-5-4-11-20(21)22)33-24-14-7-6-13-23(24)32-26(29(33)35)25-15-8-18-36-25/h4-8,11-19,27H,1-3,9-10H2,(H,31,34) |
| InChIKey | NKWAKSKXGBMTML-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |