C25H26N2O3S — CID 24958351
2-[(4-tert-butylphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole (PubChem CID 24958351) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[(4-tert-butylphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole.
| Compound Name | 2-[(4-tert-butylphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 24958351 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[(4-tert-butylphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc(OCc2nc3ccc(-c4ccccc4S(C)(=O)=O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-25(2,3)18-10-12-19(13-11-18)30-16-24-26-21-14-9-17(15-22(21)27-24)20-7-5-6-8-23(20)31(4,28)29/h5-15H,16H2,1-4H3,(H,26,27) |
| InChIKey | JPQGTXVWZCTPAF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |