C23H22N2O4S — CID 24958354
2-[(4-ethoxyphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole (PubChem CID 24958354) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-[(4-ethoxyphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole.
| Compound Name | 2-[(4-ethoxyphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 24958354 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[(4-ethoxyphenoxy)methyl]-6-(2-methylsulfonylphenyl)-1H-benzimidazole |
| SMILES | CCOc1ccc(OCc2nc3ccc(-c4ccccc4S(C)(=O)=O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c1-3-28-17-9-11-18(12-10-17)29-15-23-24-20-13-8-16(14-21(20)25-23)19-6-4-5-7-22(19)30(2,26)27/h4-14H,3,15H2,1-2H3,(H,24,25) |
| InChIKey | VEOHTJJNCSOBRX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |