C30H23N9 — CID 24964269
1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclobutan-1-amine (PubChem CID 24964269) has the molecular formula C30H23N9 and a molecular weight of 509.58 g/mol. Its IUPAC name is 1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclobutan-1-amine.
| Compound Name | 1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 24964269 |
| Molecular Formula | C30H23N9 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclobutan-1-amine |
| SMILES | NC1(c2ccc(-c3nc4ccn5c(-c6nc7ncccn7n6)nnc5c4cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C30H23N9/c31-30(13-4-14-30)21-10-8-20(9-11-21)25-22(19-6-2-1-3-7-19)18-23-24(33-25)12-17-38-27(23)35-36-28(38)26-34-29-32-15-5-16-39(29)37-26/h1-3,5-12,15-18H,4,13-14,31H2 |
| InChIKey | YYZJOZFZDVHALC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |