C29H21N9 — CID 59473046
1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclopropan-1-amine (PubChem CID 59473046) has the molecular formula C29H21N9 and a molecular weight of 495.55 g/mol. Its IUPAC name is 1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclopropan-1-amine.
| Compound Name | 1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 59473046 |
| Molecular Formula | C29H21N9 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-[4-[9-phenyl-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]cyclopropan-1-amine |
| SMILES | NC1(c2ccc(-c3nc4ccn5c(-c6nc7ncccn7n6)nnc5c4cc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H21N9/c30-29(12-13-29)20-9-7-19(8-10-20)24-21(18-5-2-1-3-6-18)17-22-23(32-24)11-16-37-26(22)34-35-27(37)25-33-28-31-14-4-15-38(28)36-25/h1-11,14-17H,12-13,30H2 |
| InChIKey | JSWJAQFVHYGTLS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |