C27H22N4O3 — CID 24964301
3-(2-hydroxyphenyl)-N-(2-phenoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 24964301) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-N-(2-phenoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 3-(2-hydroxyphenyl)-N-(2-phenoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 24964301 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 3-(2-hydroxyphenyl)-N-(2-phenoxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C27H22N4O3/c32-25-14-6-4-12-21(25)24-17-23(19-9-8-16-28-18-19)30-31(24)27(33)29-22-13-5-7-15-26(22)34-20-10-2-1-3-11-20/h1-16,18,24,32H,17H2,(H,29,33) |
| InChIKey | DPKQYJNYMKJPAI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|