C32H53N5O7S — CID 24965676
2-[(3S,13S,16R,17R,19S)-3-(2-tert-butylsulfonylethylcarbamoylamino)-18,18-dimethyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide (PubChem CID 24965676) has the molecular formula C32H53N5O7S and a molecular weight of 651.87 g/mol. Its IUPAC name is 2-[(3S,13S,16R,17R,19S)-3-(2-tert-butylsulfonylethylcarbamoylamino)-18,18-dimethyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide.
| Compound Name | 2-[(3S,13S,16R,17R,19S)-3-(2-tert-butylsulfonylethylcarbamoylamino)-18,18-dimethyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 24965676 |
| Molecular Formula | C32H53N5O7S |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | 2-[(3S,13S,16R,17R,19S)-3-(2-tert-butylsulfonylethylcarbamoylamino)-18,18-dimethyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-13-yl]-2-oxo-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(=O)[C@@H]1CCCCCCCCC[C@H](NC(=O)NCCS(=O)(=O)C(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C32H53N5O7S/c1-7-17-33-28(40)26(38)22-15-13-11-9-8-10-12-14-16-23(36-30(42)34-18-19-45(43,44)31(2,3)4)29(41)37-20-21-24(32(21,5)6)25(37)27(39)35-22/h7,21-25H,1,8-20H2,2-6H3,(H,33,40)(H,35,39)(H2,34,36,42)/t21-,22-,23-,24-,25+/m0/s1 |
| InChIKey | CEJYQVJKGVZKKN-KFEALIJWSA-N |
| XLogP | 2.23 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|