C30H48N4O6 — CID 16755999
tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate (PubChem CID 16755999) has the molecular formula C30H48N4O6 and a molecular weight of 560.74 g/mol. Its IUPAC name is tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
|---|---|
| PubChem CID | 16755999 |
| Molecular Formula | C30H48N4O6 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
| SMILES | C=CCNC(=O)C(=O)[C@@H]1CCCCCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C30H48N4O6/c1-7-17-31-26(37)24(35)20-15-13-11-9-8-10-12-14-16-21(33-28(39)40-29(2,3)4)27(38)34-18-19-22(30(19,5)6)23(34)25(36)32-20/h7,19-23H,1,8-18H2,2-6H3,(H,31,37)(H,32,36)(H,33,39)/t19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | KCGQQQFOEAVEDN-VUBDRERZSA-N |
| XLogP | 3.24 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|