C28H44N4O6 — CID 70335686
tert-butyl N-[(3S,12S,15S,16R)-12-[2-(cyclopropylamino)-2-oxoacetyl]-16-ethenyl-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadecan-3-yl]carbamate (PubChem CID 70335686) has the molecular formula C28H44N4O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is tert-butyl N-[(3S,12S,15S,16R)-12-[2-(cyclopropylamino)-2-oxoacetyl]-16-ethenyl-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,12S,15S,16R)-12-[2-(cyclopropylamino)-2-oxoacetyl]-16-ethenyl-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadecan-3-yl]carbamate |
|---|---|
| PubChem CID | 70335686 |
| Molecular Formula | C28H44N4O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | tert-butyl N-[(3S,12S,15S,16R)-12-[2-(cyclopropylamino)-2-oxoacetyl]-16-ethenyl-2,14-dioxo-1,13-diazabicyclo[13.3.0]octadecan-3-yl]carbamate |
| SMILES | C=C[C@H]1CCN2C(=O)[C@@H](NC(=O)OC(C)(C)C)CCCCCCCC[C@@H](C(=O)C(=O)NC3CC3)NC(=O)[C@H]12 |
| InChI | InChI=1S/C28H44N4O6/c1-5-18-16-17-32-22(18)24(34)30-20(23(33)25(35)29-19-14-15-19)12-10-8-6-7-9-11-13-21(26(32)36)31-27(37)38-28(2,3)4/h5,18-22H,1,6-17H2,2-4H3,(H,29,35)(H,30,34)(H,31,37)/t18-,20-,21-,22-/m0/s1 |
| InChIKey | YSBNZXVHHOUPMB-QESAQDPVSA-N |
| XLogP | 2.75 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|