C36H56N4O8S — CID 143025424
tert-butyl N-[(3S,14S,17S)-14-[2-[(4-methylphenyl)sulfonylmethylamino]-2-oxoacetyl]-2,16-dioxo-19-propan-2-yl-1,15-diazabicyclo[15.3.0]icosan-3-yl]carbamate (PubChem CID 143025424) has the molecular formula C36H56N4O8S and a molecular weight of 704.93 g/mol. Its IUPAC name is tert-butyl N-[(3S,14S,17S)-14-[2-[(4-methylphenyl)sulfonylmethylamino]-2-oxoacetyl]-2,16-dioxo-19-propan-2-yl-1,15-diazabicyclo[15.3.0]icosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,14S,17S)-14-[2-[(4-methylphenyl)sulfonylmethylamino]-2-oxoacetyl]-2,16-dioxo-19-propan-2-yl-1,15-diazabicyclo[15.3.0]icosan-3-yl]carbamate |
|---|---|
| PubChem CID | 143025424 |
| Molecular Formula | C36H56N4O8S |
| Molecular Weight | 704.93 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | tert-butyl N-[(3S,14S,17S)-14-[2-[(4-methylphenyl)sulfonylmethylamino]-2-oxoacetyl]-2,16-dioxo-19-propan-2-yl-1,15-diazabicyclo[15.3.0]icosan-3-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)CNC(=O)C(=O)[C@@H]2CCCCCCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N3CC(C(C)C)C[C@H]3C(=O)N2)cc1 |
| InChI | InChI=1S/C36H56N4O8S/c1-24(2)26-21-30-32(42)38-28(31(41)33(43)37-23-49(46,47)27-19-17-25(3)18-20-27)15-13-11-9-7-8-10-12-14-16-29(34(44)40(30)22-26)39-35(45)48-36(4,5)6/h17-20,24,26,28-30H,7-16,21-23H2,1-6H3,(H,37,43)(H,38,42)(H,39,45)/t26?,28-,29-,30-/m0/s1 |
| InChIKey | YNXMGHXANPCEBU-MMEARPQQSA-N |
| XLogP | 4.58 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|