C28H30FN3O5 — CID 24965753
N-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide (PubChem CID 24965753) has the molecular formula C28H30FN3O5 and a molecular weight of 507.56 g/mol. Its IUPAC name is N-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide.
| Compound Name | N-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 24965753 |
| Molecular Formula | C28H30FN3O5 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1cc(F)cc(N2CCOCC2)c1)C(=O)c1ccc(OCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C28H30FN3O5/c29-20-17-21(19-22(18-20)32-10-14-36-15-11-32)30-28(34)27(33)25-5-6-26(24-4-2-1-3-23(24)25)37-16-9-31-7-12-35-13-8-31/h1-6,17-19H,7-16H2,(H,30,34) |
| InChIKey | LDUYGDQPJNZNEN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|