C34H42N4O5 — CID 69252746
3-tert-butyl-5-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]-N-piperidin-3-ylbenzamide (PubChem CID 69252746) has the molecular formula C34H42N4O5 and a molecular weight of 586.73 g/mol. Its IUPAC name is 3-tert-butyl-5-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]-N-piperidin-3-ylbenzamide.
| Compound Name | 3-tert-butyl-5-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 69252746 |
| Molecular Formula | C34H42N4O5 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 3-tert-butyl-5-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]-N-piperidin-3-ylbenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C(=O)c2ccc(OCCN3CCOCC3)c3ccccc23)cc(C(=O)NC2CCCNC2)c1 |
| InChI | InChI=1S/C34H42N4O5/c1-34(2,3)24-19-23(32(40)36-25-7-6-12-35-22-25)20-26(21-24)37-33(41)31(39)29-10-11-30(28-9-5-4-8-27(28)29)43-18-15-38-13-16-42-17-14-38/h4-5,8-11,19-21,25,35H,6-7,12-18,22H2,1-3H3,(H,36,40)(H,37,41) |
| InChIKey | SNKUXOOSUGSAOV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|