C29H33N3O7 — CID 57418855
2-(5-tert-butyl-2-methoxy-3-nitrophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide (PubChem CID 57418855) has the molecular formula C29H33N3O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methoxy-3-nitrophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide.
| Compound Name | 2-(5-tert-butyl-2-methoxy-3-nitrophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 57418855 |
| Molecular Formula | C29H33N3O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 2-(5-tert-butyl-2-methoxy-3-nitrophenyl)-N-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetamide |
| SMILES | COc1c(C(=O)C(=O)Nc2ccc(OCCN3CCOCC3)c3ccccc23)cc(C(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H33N3O7/c1-29(2,3)19-17-22(27(37-4)24(18-19)32(35)36)26(33)28(34)30-23-9-10-25(21-8-6-5-7-20(21)23)39-16-13-31-11-14-38-15-12-31/h5-10,17-18H,11-16H2,1-4H3,(H,30,34) |
| InChIKey | XRWDARXHZDXIRD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|