C32H41N3O6S — CID 67819408
(Z)-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]but-2-enamide (PubChem CID 67819408) has the molecular formula C32H41N3O6S and a molecular weight of 595.76 g/mol. Its IUPAC name is (Z)-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]but-2-enamide.
| Compound Name | (Z)-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 67819408 |
| Molecular Formula | C32H41N3O6S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | (Z)-N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]but-2-enamide |
| SMILES | C/C=C(\C(=O)Nc1cc(C(C)(C)C)cc(NS(C)(=O)=O)c1OC)c1ccc(OCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C32H41N3O6S/c1-7-23(31(36)33-27-20-22(32(2,3)4)21-28(30(27)39-5)34-42(6,37)38)25-12-13-29(26-11-9-8-10-24(25)26)41-19-16-35-14-17-40-18-15-35/h7-13,20-21,34H,14-19H2,1-6H3,(H,33,36)/b23-7- |
| InChIKey | UKRWDAAKDHAPSD-FINSYCMTSA-N |
| XLogP | 5.27 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|