C29H38N3O6S+ — CID 127030284
2-[4-[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-2-oxoacetyl]naphthalen-1-yl]oxyethyl-trimethylazanium (PubChem CID 127030284) has the molecular formula C29H38N3O6S+ and a molecular weight of 556.71 g/mol. Its IUPAC name is 2-[4-[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-2-oxoacetyl]naphthalen-1-yl]oxyethyl-trimethylazanium.
| Compound Name | 2-[4-[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-2-oxoacetyl]naphthalen-1-yl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 127030284 |
| Molecular Formula | C29H38N3O6S+ |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 2-[4-[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-2-oxoacetyl]naphthalen-1-yl]oxyethyl-trimethylazanium |
| SMILES | COc1c(NC(=O)C(=O)c2ccc(OCC[N+](C)(C)C)c3ccccc23)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C29H37N3O6S/c1-29(2,3)19-17-23(27(37-7)24(18-19)31-39(8,35)36)30-28(34)26(33)22-13-14-25(38-16-15-32(4,5)6)21-12-10-9-11-20(21)22/h9-14,17-18,31H,15-16H2,1-8H3/p+1 |
| InChIKey | NIACFYGCBYZJHU-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|