C34H37N3O5 — CID 69258418
2-[4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)ethoxy]naphthalen-1-yl]-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-oxoacetamide (PubChem CID 69258418) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is 2-[4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)ethoxy]naphthalen-1-yl]-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-[4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)ethoxy]naphthalen-1-yl]-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 69258418 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-[4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)ethoxy]naphthalen-1-yl]-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-oxoacetamide |
| SMILES | COc1c(C#N)cc(C(C)(C)C)cc1NC(=O)C(=O)c1ccc(OCCN2CC3C4CCC(O4)C3C2)c2ccccc12 |
| InChI | InChI=1S/C34H37N3O5/c1-34(2,3)21-15-20(17-35)32(40-4)27(16-21)36-33(39)31(38)24-9-10-28(23-8-6-5-7-22(23)24)41-14-13-37-18-25-26(19-37)30-12-11-29(25)42-30/h5-10,15-16,25-26,29-30H,11-14,18-19H2,1-4H3,(H,36,39) |
| InChIKey | HCOQEYGIJLZEJJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|