C32H36N4O5 — CID 87752686
(2E)-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-hydroxyimino-2-[4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethoxy]naphthalen-1-yl]acetamide (PubChem CID 87752686) has the molecular formula C32H36N4O5 and a molecular weight of 556.66 g/mol. Its IUPAC name is (2E)-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-hydroxyimino-2-[4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethoxy]naphthalen-1-yl]acetamide.
| Compound Name | (2E)-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-hydroxyimino-2-[4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethoxy]naphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 87752686 |
| Molecular Formula | C32H36N4O5 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | (2E)-N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-hydroxyimino-2-[4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethoxy]naphthalen-1-yl]acetamide |
| SMILES | COc1c(C#N)cc(C(C)(C)C)cc1NC(=O)/C(=N/O)c1ccc(OCCN2CC3CCC(C2)O3)c2ccccc12 |
| InChI | InChI=1S/C32H36N4O5/c1-32(2,3)21-15-20(17-33)30(39-4)27(16-21)34-31(37)29(35-38)26-11-12-28(25-8-6-5-7-24(25)26)40-14-13-36-18-22-9-10-23(19-36)41-22/h5-8,11-12,15-16,22-23,38H,9-10,13-14,18-19H2,1-4H3,(H,34,37)/b35-29+ |
| InChIKey | QYSMQPLOZIELTA-OZMGXUMRSA-N |
| XLogP | 5.08 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|