C32H36N6O7S — CID 173045473
N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylpyrimidin-4-yl)oxynaphthalen-1-yl]acetamide (PubChem CID 173045473) has the molecular formula C32H36N6O7S and a molecular weight of 648.74 g/mol. Its IUPAC name is N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylpyrimidin-4-yl)oxynaphthalen-1-yl]acetamide.
| Compound Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylpyrimidin-4-yl)oxynaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 173045473 |
| Molecular Formula | C32H36N6O7S |
| Molecular Weight | 648.74 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylpyrimidin-4-yl)oxynaphthalen-1-yl]acetamide |
| SMILES | COc1c(NC(=O)C(=NO)c2ccc(Oc3ccnc(N4CCOCC4)n3)c3ccccc23)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C32H36N6O7S/c1-32(2,3)20-18-24(29(43-4)25(19-20)37-46(5,41)42)34-30(39)28(36-40)23-10-11-26(22-9-7-6-8-21(22)23)45-27-12-13-33-31(35-27)38-14-16-44-17-15-38/h6-13,18-19,37,40H,14-17H2,1-5H3,(H,34,39) |
| InChIKey | MWQODJRMEOMZMO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 164.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.74 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|