C25H28N2O6S — CID 16733917
N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-(4-methoxynaphthalen-1-yl)-2-oxoacetamide (PubChem CID 16733917) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-(4-methoxynaphthalen-1-yl)-2-oxoacetamide.
| Compound Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-(4-methoxynaphthalen-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 16733917 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-2-(4-methoxynaphthalen-1-yl)-2-oxoacetamide |
| SMILES | COc1c(NC(=O)C(=O)c2ccc(OC)c3ccccc23)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C25H28N2O6S/c1-25(2,3)15-13-19(23(33-5)20(14-15)27-34(6,30)31)26-24(29)22(28)18-11-12-21(32-4)17-10-8-7-9-16(17)18/h7-14,27H,1-6H3,(H,26,29) |
| InChIKey | VPGRAFNAIUQWPV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|