C30H35N3O6S — CID 24965399
N-[5-tert-butyl-2-methoxy-3-(propylsulfonylamino)phenyl]-2-[4-(3-cyanopropoxy)naphthalen-1-yl]-2-oxoacetamide (PubChem CID 24965399) has the molecular formula C30H35N3O6S and a molecular weight of 565.69 g/mol. Its IUPAC name is N-[5-tert-butyl-2-methoxy-3-(propylsulfonylamino)phenyl]-2-[4-(3-cyanopropoxy)naphthalen-1-yl]-2-oxoacetamide.
| Compound Name | N-[5-tert-butyl-2-methoxy-3-(propylsulfonylamino)phenyl]-2-[4-(3-cyanopropoxy)naphthalen-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 24965399 |
| Molecular Formula | C30H35N3O6S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | N-[5-tert-butyl-2-methoxy-3-(propylsulfonylamino)phenyl]-2-[4-(3-cyanopropoxy)naphthalen-1-yl]-2-oxoacetamide |
| SMILES | CCCS(=O)(=O)Nc1cc(C(C)(C)C)cc(NC(=O)C(=O)c2ccc(OCCCC#N)c3ccccc23)c1OC |
| InChI | InChI=1S/C30H35N3O6S/c1-6-17-40(36,37)33-25-19-20(30(2,3)4)18-24(28(25)38-5)32-29(35)27(34)23-13-14-26(39-16-10-9-15-31)22-12-8-7-11-21(22)23/h7-8,11-14,18-19,33H,6,9-10,16-17H2,1-5H3,(H,32,35) |
| InChIKey | LINCVPFRSZVULF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|