C22H30N2O6S — CID 121255533
[5-tert-butyl-2-methoxy-3-(3-phenylmethoxypropylsulfonylamino)phenyl]carbamic acid (PubChem CID 121255533) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is [5-tert-butyl-2-methoxy-3-(3-phenylmethoxypropylsulfonylamino)phenyl]carbamic acid.
| Compound Name | [5-tert-butyl-2-methoxy-3-(3-phenylmethoxypropylsulfonylamino)phenyl]carbamic acid |
|---|---|
| PubChem CID | 121255533 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [5-tert-butyl-2-methoxy-3-(3-phenylmethoxypropylsulfonylamino)phenyl]carbamic acid |
| SMILES | COc1c(NC(=O)O)cc(C(C)(C)C)cc1NS(=O)(=O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C22H30N2O6S/c1-22(2,3)17-13-18(23-21(25)26)20(29-4)19(14-17)24-31(27,28)12-8-11-30-15-16-9-6-5-7-10-16/h5-7,9-10,13-14,23-24H,8,11-12,15H2,1-4H3,(H,25,26) |
| InChIKey | ADYSTQPVAZZVOG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|