C33H43N5O8S — CID 90794440
ethyl N-[[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate (PubChem CID 90794440) has the molecular formula C33H43N5O8S and a molecular weight of 669.80 g/mol. Its IUPAC name is ethyl N-[[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate.
| Compound Name | ethyl N-[[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate |
|---|---|
| PubChem CID | 90794440 |
| Molecular Formula | C33H43N5O8S |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | ethyl N-[[2-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate |
| SMILES | CCOC(=O)NN=C(C(=O)Nc1cc(C(C)(C)C)cc(NS(C)(=O)=O)c1OC)c1ccc(OCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C33H43N5O8S/c1-7-45-32(40)36-35-29(31(39)34-26-20-22(33(2,3)4)21-27(30(26)43-5)37-47(6,41)42)25-12-13-28(24-11-9-8-10-23(24)25)46-19-16-38-14-17-44-18-15-38/h8-13,20-21,37H,7,14-19H2,1-6H3,(H,34,39)(H,36,40) |
| InChIKey | MVRAUTPJEMMGDO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|