C25H30N4O5 — CID 173045498
N-(3-tert-butyl-1,2-oxazol-5-yl)-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide (PubChem CID 173045498) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2-oxazol-5-yl)-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide.
| Compound Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 173045498 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C(=NO)c2ccc(OCCN3CCOCC3)c3ccccc23)on1 |
| InChI | InChI=1S/C25H30N4O5/c1-25(2,3)21-16-22(34-28-21)26-24(30)23(27-31)19-8-9-20(18-7-5-4-6-17(18)19)33-15-12-29-10-13-32-14-11-29/h4-9,16,31H,10-15H2,1-3H3,(H,26,30) |
| InChIKey | LOZJAKOSZXAODA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|