C33H39N5O4 — CID 173045490
N-[3-tert-butyl-4-methyl-1-(4-methylphenyl)pyrazol-5-yl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide (PubChem CID 173045490) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is N-[3-tert-butyl-4-methyl-1-(4-methylphenyl)pyrazol-5-yl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide.
| Compound Name | N-[3-tert-butyl-4-methyl-1-(4-methylphenyl)pyrazol-5-yl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 173045490 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | N-[3-tert-butyl-4-methyl-1-(4-methylphenyl)pyrazol-5-yl]-2-hydroxyimino-2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]acetamide |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)c(C)c2NC(=O)C(=NO)c2ccc(OCCN3CCOCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H39N5O4/c1-22-10-12-24(13-11-22)38-31(23(2)30(35-38)33(3,4)5)34-32(39)29(36-40)27-14-15-28(26-9-7-6-8-25(26)27)42-21-18-37-16-19-41-20-17-37/h6-15,40H,16-21H2,1-5H3,(H,34,39) |
| InChIKey | METKAUILGHGXLG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|