C36H45N5O7 — CID 87264921
ethyl N-[(E)-[2-[5-tert-butyl-3-(cyclopropylcarbamoyl)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate (PubChem CID 87264921) has the molecular formula C36H45N5O7 and a molecular weight of 659.78 g/mol. Its IUPAC name is ethyl N-[(E)-[2-[5-tert-butyl-3-(cyclopropylcarbamoyl)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate.
| Compound Name | ethyl N-[(E)-[2-[5-tert-butyl-3-(cyclopropylcarbamoyl)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate |
|---|---|
| PubChem CID | 87264921 |
| Molecular Formula | C36H45N5O7 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | ethyl N-[(E)-[2-[5-tert-butyl-3-(cyclopropylcarbamoyl)-2-methoxyanilino]-1-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoethylidene]amino]carbamate |
| SMILES | CCOC(=O)N/N=C(/C(=O)Nc1cc(C(C)(C)C)cc(C(=O)NC2CC2)c1OC)c1ccc(OCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C36H45N5O7/c1-6-47-35(44)40-39-31(27-13-14-30(26-10-8-7-9-25(26)27)48-20-17-41-15-18-46-19-16-41)34(43)38-29-22-23(36(2,3)4)21-28(32(29)45-5)33(42)37-24-11-12-24/h7-10,13-14,21-22,24H,6,11-12,15-20H2,1-5H3,(H,37,42)(H,38,43)(H,40,44)/b39-31+ |
| InChIKey | HCZRULBBXMAYLZ-KGHBKMJJSA-N |
| XLogP | 4.84 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|