C25H17N5O2S — CID 24966064
4-[4-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carbonyl]-1,3-thiazol-2-yl]benzonitrile (PubChem CID 24966064) has the molecular formula C25H17N5O2S and a molecular weight of 451.51 g/mol. Its IUPAC name is 4-[4-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carbonyl]-1,3-thiazol-2-yl]benzonitrile.
| Compound Name | 4-[4-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carbonyl]-1,3-thiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 24966064 |
| Molecular Formula | C25H17N5O2S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 4-[4-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazole-2-carbonyl]-1,3-thiazol-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(C(=O)N3N=C(c4cccnc4)CC3c3ccccc3O)cs2)cc1 |
| InChI | InChI=1S/C25H17N5O2S/c26-13-16-7-9-17(10-8-16)24-28-21(15-33-24)25(32)30-22(19-5-1-2-6-23(19)31)12-20(29-30)18-4-3-11-27-14-18/h1-11,14-15,22,31H,12H2 |
| InChIKey | XSRSUFAJDAXHLP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|