C19H16BrN3O2S — CID 89256949
(2-bromo-2,3-dihydrothiophen-5-yl)-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 89256949) has the molecular formula C19H16BrN3O2S and a molecular weight of 430.33 g/mol. Its IUPAC name is (2-bromo-2,3-dihydrothiophen-5-yl)-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]methanone.
| Compound Name | (2-bromo-2,3-dihydrothiophen-5-yl)-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]methanone |
|---|---|
| PubChem CID | 89256949 |
| Molecular Formula | C19H16BrN3O2S |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (2-bromo-2,3-dihydrothiophen-5-yl)-[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | O=C(C1=CCC(Br)S1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C19H16BrN3O2S/c20-18-8-7-17(26-18)19(25)23-15(13-5-1-2-6-16(13)24)10-14(22-23)12-4-3-9-21-11-12/h1-7,9,11,15,18,24H,8,10H2 |
| InChIKey | ZAYPAIXBMWIPRF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|