C21H21ClF2N2O2 — CID 24966310
(1R)-6-chloro-N-(4,4-difluorobutyl)-3-oxo-2-(1-phenylethyl)-1H-isoindole-1-carboxamide (PubChem CID 24966310) has the molecular formula C21H21ClF2N2O2 and a molecular weight of 406.86 g/mol. Its IUPAC name is (1R)-6-chloro-N-(4,4-difluorobutyl)-3-oxo-2-(1-phenylethyl)-1H-isoindole-1-carboxamide.
| Compound Name | (1R)-6-chloro-N-(4,4-difluorobutyl)-3-oxo-2-(1-phenylethyl)-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 24966310 |
| Molecular Formula | C21H21ClF2N2O2 |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (1R)-6-chloro-N-(4,4-difluorobutyl)-3-oxo-2-(1-phenylethyl)-1H-isoindole-1-carboxamide |
| SMILES | CC(c1ccccc1)N1C(=O)c2ccc(Cl)cc2[C@@H]1C(=O)NCCCC(F)F |
| InChI | InChI=1S/C21H21ClF2N2O2/c1-13(14-6-3-2-4-7-14)26-19(20(27)25-11-5-8-18(23)24)17-12-15(22)9-10-16(17)21(26)28/h2-4,6-7,9-10,12-13,18-19H,5,8,11H2,1H3,(H,25,27)/t13?,19-/m1/s1 |
| InChIKey | HKESRNGXXZQCJA-GAGCMDECSA-N |
| XLogP | 4.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|