C26H23F3N2O2 — CID 68774032
2-benzhydryl-3-oxo-N-(4,4,4-trifluorobutyl)-1H-isoindole-1-carboxamide (PubChem CID 68774032) has the molecular formula C26H23F3N2O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is 2-benzhydryl-3-oxo-N-(4,4,4-trifluorobutyl)-1H-isoindole-1-carboxamide.
| Compound Name | 2-benzhydryl-3-oxo-N-(4,4,4-trifluorobutyl)-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 68774032 |
| Molecular Formula | C26H23F3N2O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-benzhydryl-3-oxo-N-(4,4,4-trifluorobutyl)-1H-isoindole-1-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)C1c2ccccc2C(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23F3N2O2/c27-26(28,29)16-9-17-30-24(32)23-20-14-7-8-15-21(20)25(33)31(23)22(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-8,10-15,22-23H,9,16-17H2,(H,30,32) |
| InChIKey | COTJYJXSEYLLGT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|