C28H22FN3O2 — CID 68771734
N-benzyl-2-[(4-fluorophenyl)-pyridin-3-ylmethyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 68771734) has the molecular formula C28H22FN3O2 and a molecular weight of 451.50 g/mol. Its IUPAC name is N-benzyl-2-[(4-fluorophenyl)-pyridin-3-ylmethyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | N-benzyl-2-[(4-fluorophenyl)-pyridin-3-ylmethyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 68771734 |
| Molecular Formula | C28H22FN3O2 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-benzyl-2-[(4-fluorophenyl)-pyridin-3-ylmethyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1c2ccccc2C(=O)N1C(c1ccc(F)cc1)c1cccnc1 |
| InChI | InChI=1S/C28H22FN3O2/c29-22-14-12-20(13-15-22)25(21-9-6-16-30-18-21)32-26(23-10-4-5-11-24(23)28(32)34)27(33)31-17-19-7-2-1-3-8-19/h1-16,18,25-26H,17H2,(H,31,33) |
| InChIKey | UKZUIGLWASKMLL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |