C13H14F3NO3 — CID 104601719
2-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]benzoic acid (PubChem CID 104601719) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]benzoic acid.
| Compound Name | 2-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]benzoic acid |
|---|---|
| PubChem CID | 104601719 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]benzoic acid |
| SMILES | O=C(Cc1ccccc1C(=O)O)NCCCC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3/c14-13(15,16)6-3-7-17-11(18)8-9-4-1-2-5-10(9)12(19)20/h1-2,4-5H,3,6-8H2,(H,17,18)(H,19,20) |
| InChIKey | UCOVZESFQGVJOJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|