C25H25N5OSi — CID 24966340
5-[3-[2-amino-1-methyl-5-oxo-4-(4-trimethylsilylphenyl)imidazol-4-yl]phenyl]pyridine-3-carbonitrile (PubChem CID 24966340) has the molecular formula C25H25N5OSi and a molecular weight of 439.60 g/mol. Its IUPAC name is 5-[3-[2-amino-1-methyl-5-oxo-4-(4-trimethylsilylphenyl)imidazol-4-yl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 5-[3-[2-amino-1-methyl-5-oxo-4-(4-trimethylsilylphenyl)imidazol-4-yl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 24966340 |
| Molecular Formula | C25H25N5OSi |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-[3-[2-amino-1-methyl-5-oxo-4-(4-trimethylsilylphenyl)imidazol-4-yl]phenyl]pyridine-3-carbonitrile |
| SMILES | CN1C(=O)C(c2ccc([Si](C)(C)C)cc2)(c2cccc(-c3cncc(C#N)c3)c2)N=C1N |
| InChI | InChI=1S/C25H25N5OSi/c1-30-23(31)25(29-24(30)27,20-8-10-22(11-9-20)32(2,3)4)21-7-5-6-18(13-21)19-12-17(14-26)15-28-16-19/h5-13,15-16H,1-4H3,(H2,27,29) |
| InChIKey | UEGSVDMQWYHIRX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|