C11H14N2S — CID 24967145
1-tert-butyl-2H-imidazo[1,5-a]pyridine-3-thione (PubChem CID 24967145) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-tert-butyl-2H-imidazo[1,5-a]pyridine-3-thione.
| Compound Name | 1-tert-butyl-2H-imidazo[1,5-a]pyridine-3-thione |
|---|---|
| PubChem CID | 24967145 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-tert-butyl-2H-imidazo[1,5-a]pyridine-3-thione |
| SMILES | CC(C)(C)c1[nH]c(=S)n2ccccc12 |
| InChI | InChI=1S/C11H14N2S/c1-11(2,3)9-8-6-4-5-7-13(8)10(14)12-9/h4-7H,1-3H3,(H,12,14) |
| InChIKey | SLBVNZTVFNCFJV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|