C28H28ClN3O2S — CID 24969323
3-[4-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 24969323) has the molecular formula C28H28ClN3O2S and a molecular weight of 506.07 g/mol. Its IUPAC name is 3-[4-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[4-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24969323 |
| Molecular Formula | C28H28ClN3O2S |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 3-[4-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-6-(4-chlorophenyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sc(-c3ccc(Cl)cc3)cc2ncn1-c1ccc(OC[C@@H]2CCCN3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C28H28ClN3O2S/c29-21-8-6-19(7-9-21)26-16-24-27(35-26)28(33)32(18-30-24)22-10-12-23(13-11-22)34-17-20-4-3-15-31-14-2-1-5-25(20)31/h6-13,16,18,20,25H,1-5,14-15,17H2/t20-,25+/m0/s1 |
| InChIKey | DZWQMAZTYWHXDU-NBGIEHNGSA-N |
| XLogP | 6.41 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |