C13H7BrF5NO — CID 24970534
1-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-1-ium-1-ylethanone bromide (PubChem CID 24970534) has the molecular formula C13H7BrF5NO and a molecular weight of 368.10 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-1-ium-1-ylethanone bromide.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-1-ium-1-ylethanone bromide |
|---|---|
| PubChem CID | 24970534 |
| Molecular Formula | C13H7BrF5NO |
| Molecular Weight | 368.10 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-1-ium-1-ylethanone bromide |
| SMILES | O=C(C[n+]1ccccc1)c1c(F)c(F)c(F)c(F)c1F.[Br-] |
| InChI | InChI=1S/C13H7F5NO.BrH/c14-9-8(10(15)12(17)13(18)11(9)16)7(20)6-19-4-2-1-3-5-19;/h1-5H,6H2;1H/q+1;/p-1 |
| InChIKey | WCYNLGSIOVMTNP-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.10 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|