C8H7F3NO+ — CID 12753936
1,1,1-trifluoro-3-pyridin-1-ium-1-ylpropan-2-one (PubChem CID 12753936) has the molecular formula C8H7F3NO+ and a molecular weight of 190.14 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-pyridin-1-ium-1-ylpropan-2-one.
| Compound Name | 1,1,1-trifluoro-3-pyridin-1-ium-1-ylpropan-2-one |
|---|---|
| PubChem CID | 12753936 |
| Molecular Formula | C8H7F3NO+ |
| Molecular Weight | 190.14 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1,1,1-trifluoro-3-pyridin-1-ium-1-ylpropan-2-one |
| SMILES | O=C(C[n+]1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C8H7F3NO/c9-8(10,11)7(13)6-12-4-2-1-3-5-12/h1-5H,6H2/q+1 |
| InChIKey | LTSCWKZNWVBZEI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|