About pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride
pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride (PubChem CID 45048793) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride.
Molecular Properties
| Compound Name | pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride |
| PubChem CID | 45048793 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride |
| SMILES | O=C([O-])C[n+]1ccccc1.[Cl-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C7H7NO2.C5H5N.ClH/c9-7(10)6-8-4-2-1-3-5-8;1-2-4-6-5-3-1;/h1-5H,6H2;1-5H;1H |
| InChIKey | RRMUPIWOUXZEAT-UHFFFAOYSA-N |
| XLogP | -3.77 |
| TPSA | 58.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride?
The IUPAC name of pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride (CID 45048793) is pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride.
What is the SMILES notation for pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride?
The canonical SMILES for pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride is O=C([O-])C[n+]1ccccc1.[Cl-].c1cc[nH+]cc1.
What is the InChIKey of pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride?
The InChIKey is RRMUPIWOUXZEAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C5H5N.ClH/c9-7(10)6-8-4-2-1-3-5-8;1-2-4-6-5-3-1;/h1-5H,6H2;1-5H;1H.
What are the key properties of pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride?
pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride has a molecular weight of 252.70 g/mol, XLogP of -3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium;2-pyridin-1-ium-1-ylacetate;chloride is sourced from PubChem (CID 45048793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).