C26H23N5S2 — CID 24971388
N-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methyl]-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 24971388) has the molecular formula C26H23N5S2 and a molecular weight of 469.64 g/mol. Its IUPAC name is N-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methyl]-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methyl]-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 24971388 |
| Molecular Formula | C26H23N5S2 |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methyl]-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | CSc1ncc2cc(-c3ccccc3)c(-c3ccc(CNCCc4nccs4)cc3)nc2n1 |
| InChI | InChI=1S/C26H23N5S2/c1-32-26-29-17-21-15-22(19-5-3-2-4-6-19)24(30-25(21)31-26)20-9-7-18(8-10-20)16-27-12-11-23-28-13-14-33-23/h2-10,13-15,17,27H,11-12,16H2,1H3 |
| InChIKey | ZKGZBXPPWINVIJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|