C9H16N2O3S — CID 24971822
2,2,2-trimethoxy-1-(3-methyl-1,2-thiazol-5-yl)ethanamine (PubChem CID 24971822) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 2,2,2-trimethoxy-1-(3-methyl-1,2-thiazol-5-yl)ethanamine.
| Compound Name | 2,2,2-trimethoxy-1-(3-methyl-1,2-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 24971822 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2,2,2-trimethoxy-1-(3-methyl-1,2-thiazol-5-yl)ethanamine |
| SMILES | COC(OC)(OC)C(N)c1cc(C)ns1 |
| InChI | InChI=1S/C9H16N2O3S/c1-6-5-7(15-11-6)8(10)9(12-2,13-3)14-4/h5,8H,10H2,1-4H3 |
| InChIKey | RQYOIFICNWFJQM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|