About 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine
1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine (PubChem CID 82405705) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine.
Analyze 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine?
The IUPAC name of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine (CID 82405705) is 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine.
What is the SMILES notation for 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine?
The canonical SMILES for 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine is CCC(N)c1cc(COC)ns1.
What is the InChIKey of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine?
The InChIKey is OSAZRBIWSQNQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS/c1-3-7(9)8-4-6(5-11-2)10-12-8/h4,7H,3,5,9H2,1-2H3.
What are the key properties of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine?
1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine has a molecular weight of 186.28 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]propan-1-amine is sourced from PubChem (CID 82405705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).