methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate

C9H13NO3 — CID 24975222

IUPACmethyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate
SMILESCOC(=O)C1CC2CCCN2C1=O
InChIInChI=1S/C9H13NO3/c1-13-9(12)7-5-6-3-2-4-10(6)8(7)11/h6-7H,2-5H2,1H3
InChIKeyPHDFYSFZCBROIG-UHFFFAOYSA-N
MW183.21 g/mol
LogP0.17
Rot. Bonds1

About methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate

methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate (PubChem CID 24975222) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate
PubChem CID24975222
Molecular FormulaC9H13NO3
Molecular Weight183.21 g/mol
Exact Mass183.09
IUPAC Namemethyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate
SMILESCOC(=O)C1CC2CCCN2C1=O
InChIInChI=1S/C9H13NO3/c1-13-9(12)7-5-6-3-2-4-10(6)8(7)11/h6-7H,2-5H2,1H3
InChIKeyPHDFYSFZCBROIG-UHFFFAOYSA-N
XLogP0.17
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.21
LogP ≤ 50.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate?
The IUPAC name of methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate (CID 24975222) is methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate.
What is the SMILES notation for methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate?
The canonical SMILES for methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate is COC(=O)C1CC2CCCN2C1=O.
What is the InChIKey of methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate?
The InChIKey is PHDFYSFZCBROIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-13-9(12)7-5-6-3-2-4-10(6)8(7)11/h6-7H,2-5H2,1H3.
What are the key properties of methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate?
methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate has a molecular weight of 183.21 g/mol, XLogP of 0.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-1,2,5,6,7,8-hexahydropyrrolizine-2-carboxylate is sourced from PubChem (CID 24975222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).