C11H15NO5 — CID 13171955
dimethyl 3-oxo-5,6,7,8-tetrahydro-2H-pyrrolizine-1,1-dicarboxylate (PubChem CID 13171955) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is dimethyl 3-oxo-5,6,7,8-tetrahydro-2H-pyrrolizine-1,1-dicarboxylate.
| Compound Name | dimethyl 3-oxo-5,6,7,8-tetrahydro-2H-pyrrolizine-1,1-dicarboxylate |
|---|---|
| PubChem CID | 13171955 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | dimethyl 3-oxo-5,6,7,8-tetrahydro-2H-pyrrolizine-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(=O)N2CCCC21 |
| InChI | InChI=1S/C11H15NO5/c1-16-9(14)11(10(15)17-2)6-8(13)12-5-3-4-7(11)12/h7H,3-6H2,1-2H3 |
| InChIKey | ZKNJCNTWWXJEIT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|