C13H17NO6 — CID 533619
diethyl 3,5-dioxo-2,6,7,8-tetrahydropyrrolizine-1,1-dicarboxylate (PubChem CID 533619) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is diethyl 3,5-dioxo-2,6,7,8-tetrahydropyrrolizine-1,1-dicarboxylate.
| Compound Name | diethyl 3,5-dioxo-2,6,7,8-tetrahydropyrrolizine-1,1-dicarboxylate |
|---|---|
| PubChem CID | 533619 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | diethyl 3,5-dioxo-2,6,7,8-tetrahydropyrrolizine-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(=O)N2C(=O)CCC21 |
| InChI | InChI=1S/C13H17NO6/c1-3-19-11(17)13(12(18)20-4-2)7-10(16)14-8(13)5-6-9(14)15/h8H,3-7H2,1-2H3 |
| InChIKey | WOHUBOONSBSOJU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|